C28H34 — CID 158981757
[(3R)-3,6,6-trimethyl-2,2-diphenylheptan-3-yl]benzene (PubChem CID 158981757) has the molecular formula C28H34 and a molecular weight of 370.58 g/mol. Its IUPAC name is [(3R)-3,6,6-trimethyl-2,2-diphenylheptan-3-yl]benzene.
| Compound Name | [(3R)-3,6,6-trimethyl-2,2-diphenylheptan-3-yl]benzene |
|---|---|
| PubChem CID | 158981757 |
| Molecular Formula | C28H34 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | [(3R)-3,6,6-trimethyl-2,2-diphenylheptan-3-yl]benzene |
| SMILES | CC(C)(C)CC[C@](C)(c1ccccc1)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34/c1-26(2,3)21-22-27(4,23-15-9-6-10-16-23)28(5,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20H,21-22H2,1-5H3/t27-/m1/s1 |
| InChIKey | XRPPEYONWGOIOV-HHHXNRCGSA-N |
| XLogP | 7.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |