C21H25N — CID 122487139
6,6-dimethyl-2,2-diphenylheptanenitrile (PubChem CID 122487139) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is 6,6-dimethyl-2,2-diphenylheptanenitrile.
| Compound Name | 6,6-dimethyl-2,2-diphenylheptanenitrile |
|---|---|
| PubChem CID | 122487139 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 6,6-dimethyl-2,2-diphenylheptanenitrile |
| SMILES | CC(C)(C)CCCC(C#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N/c1-20(2,3)15-10-16-21(17-22,18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14H,10,15-16H2,1-3H3 |
| InChIKey | ZKDZUNAJTCMQOV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |