C20H25N2+ — CID 134117596
(4-cyano-4,4-diphenylbutyl)-trimethylazanium (PubChem CID 134117596) has the molecular formula C20H25N2+ and a molecular weight of 293.43 g/mol. Its IUPAC name is (4-cyano-4,4-diphenylbutyl)-trimethylazanium.
| Compound Name | (4-cyano-4,4-diphenylbutyl)-trimethylazanium |
|---|---|
| PubChem CID | 134117596 |
| Molecular Formula | C20H25N2+ |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (4-cyano-4,4-diphenylbutyl)-trimethylazanium |
| SMILES | C[N+](C)(C)CCCC(C#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25N2/c1-22(2,3)16-10-15-20(17-21,18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14H,10,15-16H2,1-3H3/q+1 |
| InChIKey | HUANHOQVWZOTML-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|