C20H25Cl2N3 — CID 44655155
2,2-diphenyl-4-piperazine-1,4-diium-1-ylbutanenitrile dichloride (PubChem CID 44655155) has the molecular formula C20H25Cl2N3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 2,2-diphenyl-4-piperazine-1,4-diium-1-ylbutanenitrile dichloride.
| Compound Name | 2,2-diphenyl-4-piperazine-1,4-diium-1-ylbutanenitrile dichloride |
|---|---|
| PubChem CID | 44655155 |
| Molecular Formula | C20H25Cl2N3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2,2-diphenyl-4-piperazine-1,4-diium-1-ylbutanenitrile dichloride |
| SMILES | N#CC(CC[NH+]1CC[NH2+]CC1)(c1ccccc1)c1ccccc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C20H23N3.2ClH/c21-17-20(18-7-3-1-4-8-18,19-9-5-2-6-10-19)11-14-23-15-12-22-13-16-23;;/h1-10,22H,11-16H2;2*1H |
| InChIKey | AFCDFHZHZKYJSY-UHFFFAOYSA-N |
| XLogP | -5.64 |
| TPSA | 44.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | -5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |