C21H24N2 — CID 97356110
2,2-diphenyl-4-[(2R)-piperidin-2-yl]butanenitrile (PubChem CID 97356110) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 2,2-diphenyl-4-[(2R)-piperidin-2-yl]butanenitrile.
| Compound Name | 2,2-diphenyl-4-[(2R)-piperidin-2-yl]butanenitrile |
|---|---|
| PubChem CID | 97356110 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2,2-diphenyl-4-[(2R)-piperidin-2-yl]butanenitrile |
| SMILES | N#CC(CC[C@H]1CCCCN1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2/c22-17-21(18-9-3-1-4-10-18,19-11-5-2-6-12-19)15-14-20-13-7-8-16-23-20/h1-6,9-12,20,23H,7-8,13-16H2/t20-/m1/s1 |
| InChIKey | UYVUZSZALSHURT-HXUWFJFHSA-N |
| XLogP | 4.42 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |