C14H21NS — CID 79223210
2-(2-phenylsulfanylethyl)azepane (PubChem CID 79223210) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is 2-(2-phenylsulfanylethyl)azepane.
| Compound Name | 2-(2-phenylsulfanylethyl)azepane |
|---|---|
| PubChem CID | 79223210 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-(2-phenylsulfanylethyl)azepane |
| SMILES | c1ccc(SCCC2CCCCCN2)cc1 |
| InChI | InChI=1S/C14H21NS/c1-4-8-14(9-5-1)16-12-10-13-7-3-2-6-11-15-13/h1,4-5,8-9,13,15H,2-3,6-7,10-12H2 |
| InChIKey | GCWCIIAGVYQIMF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |