C13H17Cl2NS — CID 97301377
(2S)-2-[2-(2,6-dichlorophenyl)sulfanylethyl]piperidine (PubChem CID 97301377) has the molecular formula C13H17Cl2NS and a molecular weight of 290.26 g/mol. Its IUPAC name is (2S)-2-[2-(2,6-dichlorophenyl)sulfanylethyl]piperidine.
| Compound Name | (2S)-2-[2-(2,6-dichlorophenyl)sulfanylethyl]piperidine |
|---|---|
| PubChem CID | 97301377 |
| Molecular Formula | C13H17Cl2NS |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (2S)-2-[2-(2,6-dichlorophenyl)sulfanylethyl]piperidine |
| SMILES | Clc1cccc(Cl)c1SCC[C@@H]1CCCCN1 |
| InChI | InChI=1S/C13H17Cl2NS/c14-11-5-3-6-12(15)13(11)17-9-7-10-4-1-2-8-16-10/h3,5-6,10,16H,1-2,4,7-9H2/t10-/m0/s1 |
| InChIKey | IOFRYYBJHCPYQO-JTQLQIEISA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |