C14H21Cl2NO — CID 56829905
2-[2-[(2-chlorophenyl)methoxy]ethyl]piperidine;hydrochloride (PubChem CID 56829905) has the molecular formula C14H21Cl2NO and a molecular weight of 290.23 g/mol. Its IUPAC name is 2-[2-[(2-chlorophenyl)methoxy]ethyl]piperidine;hydrochloride.
| Compound Name | 2-[2-[(2-chlorophenyl)methoxy]ethyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 56829905 |
| Molecular Formula | C14H21Cl2NO |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[2-[(2-chlorophenyl)methoxy]ethyl]piperidine;hydrochloride |
| SMILES | Cl.Clc1ccccc1COCCC1CCCCN1 |
| InChI | InChI=1S/C14H20ClNO.ClH/c15-14-7-2-1-5-12(14)11-17-10-8-13-6-3-4-9-16-13;/h1-2,5,7,13,16H,3-4,6,8-11H2;1H |
| InChIKey | GNZFRYWHZWPKHS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|