C12H18ClN3O — CID 97163934
2-chloro-4-[2-[(2R)-piperidin-2-yl]ethoxymethyl]pyrimidine (PubChem CID 97163934) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 2-chloro-4-[2-[(2R)-piperidin-2-yl]ethoxymethyl]pyrimidine.
| Compound Name | 2-chloro-4-[2-[(2R)-piperidin-2-yl]ethoxymethyl]pyrimidine |
|---|---|
| PubChem CID | 97163934 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-chloro-4-[2-[(2R)-piperidin-2-yl]ethoxymethyl]pyrimidine |
| SMILES | Clc1nccc(COCC[C@H]2CCCCN2)n1 |
| InChI | InChI=1S/C12H18ClN3O/c13-12-15-7-4-11(16-12)9-17-8-5-10-3-1-2-6-14-10/h4,7,10,14H,1-3,5-6,8-9H2/t10-/m1/s1 |
| InChIKey | PGAAQEQWQKYOJK-SNVBAGLBSA-N |
| XLogP | 2.18 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|