C14H19F2NO — CID 86321767
(2R)-2-[2-[(2,6-difluorophenyl)methoxy]ethyl]piperidine (PubChem CID 86321767) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is (2R)-2-[2-[(2,6-difluorophenyl)methoxy]ethyl]piperidine.
| Compound Name | (2R)-2-[2-[(2,6-difluorophenyl)methoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 86321767 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (2R)-2-[2-[(2,6-difluorophenyl)methoxy]ethyl]piperidine |
| SMILES | Fc1cccc(F)c1COCC[C@H]1CCCCN1 |
| InChI | InChI=1S/C14H19F2NO/c15-13-5-3-6-14(16)12(13)10-18-9-7-11-4-1-2-8-17-11/h3,5-6,11,17H,1-2,4,7-10H2/t11-/m1/s1 |
| InChIKey | SGEAHNGZLNCLCM-LLVKDONJSA-N |
| XLogP | 3.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|