C12H16ClNS — CID 103289465
(2S)-2-[(2-chlorophenyl)methylsulfanylmethyl]pyrrolidine (PubChem CID 103289465) has the molecular formula C12H16ClNS and a molecular weight of 241.79 g/mol. Its IUPAC name is (2S)-2-[(2-chlorophenyl)methylsulfanylmethyl]pyrrolidine.
| Compound Name | (2S)-2-[(2-chlorophenyl)methylsulfanylmethyl]pyrrolidine |
|---|---|
| PubChem CID | 103289465 |
| Molecular Formula | C12H16ClNS |
| Molecular Weight | 241.79 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | (2S)-2-[(2-chlorophenyl)methylsulfanylmethyl]pyrrolidine |
| SMILES | Clc1ccccc1CSC[C@@H]1CCCN1 |
| InChI | InChI=1S/C12H16ClNS/c13-12-6-2-1-4-10(12)8-15-9-11-5-3-7-14-11/h1-2,4,6,11,14H,3,5,7-9H2/t11-/m0/s1 |
| InChIKey | BKXJIIIXZBGZEF-NSHDSACASA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |