C12H17NOS — CID 115071010
2-(pyrrolidin-2-ylmethylsulfanylmethyl)phenol (PubChem CID 115071010) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(pyrrolidin-2-ylmethylsulfanylmethyl)phenol.
| Compound Name | 2-(pyrrolidin-2-ylmethylsulfanylmethyl)phenol |
|---|---|
| PubChem CID | 115071010 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(pyrrolidin-2-ylmethylsulfanylmethyl)phenol |
| SMILES | Oc1ccccc1CSCC1CCCN1 |
| InChI | InChI=1S/C12H17NOS/c14-12-6-2-1-4-10(12)8-15-9-11-5-3-7-13-11/h1-2,4,6,11,13-14H,3,5,7-9H2 |
| InChIKey | LMODWFFLIPCSNG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |