C12H18N2O — CID 103846509
2-[(pyrrolidin-2-ylmethylamino)methyl]phenol (PubChem CID 103846509) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-[(pyrrolidin-2-ylmethylamino)methyl]phenol.
| Compound Name | 2-[(pyrrolidin-2-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 103846509 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-[(pyrrolidin-2-ylmethylamino)methyl]phenol |
| SMILES | Oc1ccccc1CNCC1CCCN1 |
| InChI | InChI=1S/C12H18N2O/c15-12-6-2-1-4-10(12)8-13-9-11-5-3-7-14-11/h1-2,4,6,11,13-15H,3,5,7-9H2 |
| InChIKey | BLWRWDSYQPBREM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|