C12H16F2N2 — CID 106638289
N-[(2,4-difluorophenyl)methyl]-1-pyrrolidin-2-ylmethanamine (PubChem CID 106638289) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-1-pyrrolidin-2-ylmethanamine.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-1-pyrrolidin-2-ylmethanamine |
|---|---|
| PubChem CID | 106638289 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-1-pyrrolidin-2-ylmethanamine |
| SMILES | Fc1ccc(CNCC2CCCN2)c(F)c1 |
| InChI | InChI=1S/C12H16F2N2/c13-10-4-3-9(12(14)6-10)7-15-8-11-2-1-5-16-11/h3-4,6,11,15-16H,1-2,5,7-8H2 |
| InChIKey | XKCKZLXSLRPTEC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |