C12H16F2N2 — CID 115210125
2,4-difluoro-N-(2-pyrrolidin-2-ylethyl)aniline (PubChem CID 115210125) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-pyrrolidin-2-ylethyl)aniline.
| Compound Name | 2,4-difluoro-N-(2-pyrrolidin-2-ylethyl)aniline |
|---|---|
| PubChem CID | 115210125 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2,4-difluoro-N-(2-pyrrolidin-2-ylethyl)aniline |
| SMILES | Fc1ccc(NCCC2CCCN2)c(F)c1 |
| InChI | InChI=1S/C12H16F2N2/c13-9-3-4-12(11(14)8-9)16-7-5-10-2-1-6-15-10/h3-4,8,10,15-16H,1-2,5-7H2 |
| InChIKey | ORRVSYQUUBSTNS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |