C15H21BrS — CID 79228964
1-bromo-2-(2-phenylsulfanylethyl)cycloheptane (PubChem CID 79228964) has the molecular formula C15H21BrS and a molecular weight of 313.30 g/mol. Its IUPAC name is 1-bromo-2-(2-phenylsulfanylethyl)cycloheptane.
| Compound Name | 1-bromo-2-(2-phenylsulfanylethyl)cycloheptane |
|---|---|
| PubChem CID | 79228964 |
| Molecular Formula | C15H21BrS |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-bromo-2-(2-phenylsulfanylethyl)cycloheptane |
| SMILES | BrC1CCCCCC1CCSc1ccccc1 |
| InChI | InChI=1S/C15H21BrS/c16-15-10-6-1-3-7-13(15)11-12-17-14-8-4-2-5-9-14/h2,4-5,8-9,13,15H,1,3,6-7,10-12H2 |
| InChIKey | LLOKDXUZMADGDR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|