C22H26N2O — CID 154841334
4-(4-hydroxy-4-methylpiperidin-1-yl)-2,2-diphenylbutanenitrile (PubChem CID 154841334) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-(4-hydroxy-4-methylpiperidin-1-yl)-2,2-diphenylbutanenitrile.
| Compound Name | 4-(4-hydroxy-4-methylpiperidin-1-yl)-2,2-diphenylbutanenitrile |
|---|---|
| PubChem CID | 154841334 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 4-(4-hydroxy-4-methylpiperidin-1-yl)-2,2-diphenylbutanenitrile |
| SMILES | CC1(O)CCN(CCC(C#N)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N2O/c1-21(25)12-15-24(16-13-21)17-14-22(18-23,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,25H,12-17H2,1H3 |
| InChIKey | XNBLMQNJSVOJLO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |