C32H37N3 — CID 89211247
4-[4-(N-ethylanilino)-4-prop-1-en-2-ylpiperidin-1-yl]-2,2-diphenylbutanenitrile (PubChem CID 89211247) has the molecular formula C32H37N3 and a molecular weight of 463.67 g/mol. Its IUPAC name is 4-[4-(N-ethylanilino)-4-prop-1-en-2-ylpiperidin-1-yl]-2,2-diphenylbutanenitrile.
| Compound Name | 4-[4-(N-ethylanilino)-4-prop-1-en-2-ylpiperidin-1-yl]-2,2-diphenylbutanenitrile |
|---|---|
| PubChem CID | 89211247 |
| Molecular Formula | C32H37N3 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | 4-[4-(N-ethylanilino)-4-prop-1-en-2-ylpiperidin-1-yl]-2,2-diphenylbutanenitrile |
| SMILES | C=C(C)C1(N(CC)c2ccccc2)CCN(CCC(C#N)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H37N3/c1-4-35(30-18-12-7-13-19-30)32(27(2)3)21-24-34(25-22-32)23-20-31(26-33,28-14-8-5-9-15-28)29-16-10-6-11-17-29/h5-19H,2,4,20-25H2,1,3H3 |
| InChIKey | HELXKTVZEMKOLD-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|