C26H27N3O — CID 112799666
4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile (PubChem CID 112799666) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile.
| Compound Name | 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile |
|---|---|
| PubChem CID | 112799666 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile |
| SMILES | N#CC(CCN1CCN(c2ccc(O)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O/c27-21-26(22-7-3-1-4-8-22,23-9-5-2-6-10-23)15-16-28-17-19-29(20-18-28)24-11-13-25(30)14-12-24/h1-14,30H,15-20H2 |
| InChIKey | WBZHJCZMMMFGGK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |