About 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile
4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile (PubChem CID 112799666) has the molecular formula C26H27N3O
and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile.
Molecular Properties
| Compound Name | 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile |
| PubChem CID | 112799666 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile |
| SMILES | N#CC(CCN1CCN(c2ccc(O)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O/c27-21-26(22-7-3-1-4-8-22,23-9-5-2-6-10-23)15-16-28-17-19-29(20-18-28)24-11-13-25(30)14-12-24/h1-14,30H,15-20H2 |
| InChIKey | WBZHJCZMMMFGGK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile?
The IUPAC name of 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile (CID 112799666) is 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile.
What is the SMILES notation for 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile?
The canonical SMILES for 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile is N#CC(CCN1CCN(c2ccc(O)cc2)CC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile?
The InChIKey is WBZHJCZMMMFGGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N3O/c27-21-26(22-7-3-1-4-8-22,23-9-5-2-6-10-23)15-16-28-17-19-29(20-18-28)24-11-13-25(30)14-12-24/h1-14,30H,15-20H2.
What are the key properties of 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile?
4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile has a molecular weight of 397.52 g/mol, XLogP of 4.41, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-hydroxyphenyl)piperazin-1-yl]-2,2-diphenylbutanenitrile is sourced from PubChem (CID 112799666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).