C13H17F3N2 — CID 141293309
1-phenyl-4-(3,3,3-trifluoropropyl)piperazine (PubChem CID 141293309) has the molecular formula C13H17F3N2 and a molecular weight of 258.29 g/mol. Its IUPAC name is 1-phenyl-4-(3,3,3-trifluoropropyl)piperazine.
| Compound Name | 1-phenyl-4-(3,3,3-trifluoropropyl)piperazine |
|---|---|
| PubChem CID | 141293309 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 1-phenyl-4-(3,3,3-trifluoropropyl)piperazine |
| SMILES | FC(F)(F)CCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C13H17F3N2/c14-13(15,16)6-7-17-8-10-18(11-9-17)12-4-2-1-3-5-12/h1-5H,6-11H2 |
| InChIKey | IOHNPKQGNXVDTA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |