About [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide
[4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide (PubChem CID 158330325) has the molecular formula C14H19F3N3-
and a molecular weight of 286.32 g/mol. Its IUPAC name is [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide.
Molecular Properties
| Compound Name | [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide |
| PubChem CID | 158330325 |
| Molecular Formula | C14H19F3N3- |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide |
| SMILES | [NH-]c1ccc(N2CCN(CCCC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C14H19F3N3/c15-14(16,17)6-1-7-19-8-10-20(11-9-19)13-4-2-12(18)3-5-13/h2-5,18H,1,6-11H2/q-1 |
| InChIKey | GPXPOYPGEWXUFJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 30.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide?
The IUPAC name of [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide (CID 158330325) is [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide.
What is the SMILES notation for [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide?
The canonical SMILES for [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide is [NH-]c1ccc(N2CCN(CCCC(F)(F)F)CC2)cc1.
What is the InChIKey of [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide?
The InChIKey is GPXPOYPGEWXUFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3N3/c15-14(16,17)6-1-7-19-8-10-20(11-9-19)13-4-2-12(18)3-5-13/h2-5,18H,1,6-11H2/q-1.
What are the key properties of [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide?
[4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide has a molecular weight of 286.32 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide is sourced from PubChem (CID 158330325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).