C14H19F3N3- — CID 158330325
[4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide (PubChem CID 158330325) has the molecular formula C14H19F3N3- and a molecular weight of 286.32 g/mol. Its IUPAC name is [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide.
| Compound Name | [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide |
|---|---|
| PubChem CID | 158330325 |
| Molecular Formula | C14H19F3N3- |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | [4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]azanide |
| SMILES | [NH-]c1ccc(N2CCN(CCCC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C14H19F3N3/c15-14(16,17)6-1-7-19-8-10-20(11-9-19)13-4-2-12(18)3-5-13/h2-5,18H,1,6-11H2/q-1 |
| InChIKey | GPXPOYPGEWXUFJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 30.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|