C12H14BrF3N2 — CID 67513524
1-(4-bromophenyl)-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 67513524) has the molecular formula C12H14BrF3N2 and a molecular weight of 323.16 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-(4-bromophenyl)-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 67513524 |
| Molecular Formula | C12H14BrF3N2 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 1-(4-bromophenyl)-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | FC(F)(F)CN1CCN(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C12H14BrF3N2/c13-10-1-3-11(4-2-10)18-7-5-17(6-8-18)9-12(14,15)16/h1-4H,5-9H2 |
| InChIKey | IBWRNPLEYCUSLZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |