C13H16BrF3N2 — CID 60705102
1-[(3-bromophenyl)methyl]-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 60705102) has the molecular formula C13H16BrF3N2 and a molecular weight of 337.18 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-[(3-bromophenyl)methyl]-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 60705102 |
| Molecular Formula | C13H16BrF3N2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | FC(F)(F)CN1CCN(Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C13H16BrF3N2/c14-12-3-1-2-11(8-12)9-18-4-6-19(7-5-18)10-13(15,16)17/h1-3,8H,4-7,9-10H2 |
| InChIKey | MAMDDFJEYTZGPU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |