C19H20BrF3N2O — CID 170453683
1-[(4-bromo-2-phenoxyphenyl)methyl]-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 170453683) has the molecular formula C19H20BrF3N2O and a molecular weight of 429.28 g/mol. Its IUPAC name is 1-[(4-bromo-2-phenoxyphenyl)methyl]-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-[(4-bromo-2-phenoxyphenyl)methyl]-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 170453683 |
| Molecular Formula | C19H20BrF3N2O |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 1-[(4-bromo-2-phenoxyphenyl)methyl]-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | FC(F)(F)CN1CCN(Cc2ccc(Br)cc2Oc2ccccc2)CC1 |
| InChI | InChI=1S/C19H20BrF3N2O/c20-16-7-6-15(18(12-16)26-17-4-2-1-3-5-17)13-24-8-10-25(11-9-24)14-19(21,22)23/h1-7,12H,8-11,13-14H2 |
| InChIKey | QTPPJUQYTAADMH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |