C12H14BrF2N — CID 86686688
1-[(3-bromophenyl)methyl]-4,4-difluoropiperidine (PubChem CID 86686688) has the molecular formula C12H14BrF2N and a molecular weight of 290.15 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-4,4-difluoropiperidine.
| Compound Name | 1-[(3-bromophenyl)methyl]-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 86686688 |
| Molecular Formula | C12H14BrF2N |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-4,4-difluoropiperidine |
| SMILES | FC1(F)CCN(Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C12H14BrF2N/c13-11-3-1-2-10(8-11)9-16-6-4-12(14,15)5-7-16/h1-3,8H,4-7,9H2 |
| InChIKey | LWHGRRYEKLSRSM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |