C13H17F2N3O — CID 173222683
[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]urea (PubChem CID 173222683) has the molecular formula C13H17F2N3O and a molecular weight of 269.30 g/mol. Its IUPAC name is [3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]urea.
| Compound Name | [3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 173222683 |
| Molecular Formula | C13H17F2N3O |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | [3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]urea |
| SMILES | NC(=O)Nc1cccc(CN2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C13H17F2N3O/c14-13(15)4-6-18(7-5-13)9-10-2-1-3-11(8-10)17-12(16)19/h1-3,8H,4-7,9H2,(H3,16,17,19) |
| InChIKey | VVNGIGDVUUPCKI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |