C23H31ClN2 — CID 70151216
1-(4-chlorophenyl)-4-(4-methyl-4-phenylhexyl)piperazine (PubChem CID 70151216) has the molecular formula C23H31ClN2 and a molecular weight of 370.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-(4-methyl-4-phenylhexyl)piperazine.
| Compound Name | 1-(4-chlorophenyl)-4-(4-methyl-4-phenylhexyl)piperazine |
|---|---|
| PubChem CID | 70151216 |
| Molecular Formula | C23H31ClN2 |
| Molecular Weight | 370.97 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 1-(4-chlorophenyl)-4-(4-methyl-4-phenylhexyl)piperazine |
| SMILES | CCC(C)(CCCN1CCN(c2ccc(Cl)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H31ClN2/c1-3-23(2,20-8-5-4-6-9-20)14-7-15-25-16-18-26(19-17-25)22-12-10-21(24)11-13-22/h4-6,8-13H,3,7,14-19H2,1-2H3 |
| InChIKey | MMANFYCBJHEOLO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.97 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |