C26H36N2O2 — CID 142045214
methyl 6-[4-(4-ethylphenyl)piperazin-1-yl]-3-methyl-3-phenylhexanoate (PubChem CID 142045214) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is methyl 6-[4-(4-ethylphenyl)piperazin-1-yl]-3-methyl-3-phenylhexanoate.
| Compound Name | methyl 6-[4-(4-ethylphenyl)piperazin-1-yl]-3-methyl-3-phenylhexanoate |
|---|---|
| PubChem CID | 142045214 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | methyl 6-[4-(4-ethylphenyl)piperazin-1-yl]-3-methyl-3-phenylhexanoate |
| SMILES | CCc1ccc(N2CCN(CCCC(C)(CC(=O)OC)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H36N2O2/c1-4-22-11-13-24(14-12-22)28-19-17-27(18-20-28)16-8-15-26(2,21-25(29)30-3)23-9-6-5-7-10-23/h5-7,9-14H,4,8,15-21H2,1-3H3 |
| InChIKey | ZRCUAJVLJFWVLZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|