C28H33N3O2 — CID 70150689
methyl 2-methyl-2-phenyl-5-[4-(4-pyridin-2-ylphenyl)piperazin-1-yl]pentanoate (PubChem CID 70150689) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is methyl 2-methyl-2-phenyl-5-[4-(4-pyridin-2-ylphenyl)piperazin-1-yl]pentanoate.
| Compound Name | methyl 2-methyl-2-phenyl-5-[4-(4-pyridin-2-ylphenyl)piperazin-1-yl]pentanoate |
|---|---|
| PubChem CID | 70150689 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | methyl 2-methyl-2-phenyl-5-[4-(4-pyridin-2-ylphenyl)piperazin-1-yl]pentanoate |
| SMILES | COC(=O)C(C)(CCCN1CCN(c2ccc(-c3ccccn3)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H33N3O2/c1-28(27(32)33-2,24-9-4-3-5-10-24)16-8-18-30-19-21-31(22-20-30)25-14-12-23(13-15-25)26-11-6-7-17-29-26/h3-7,9-15,17H,8,16,18-22H2,1-2H3 |
| InChIKey | MHOVMUWMSHXSRG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |