C31H38N2O2 — CID 139943267
propan-2-yl 2-methyl-2-phenyl-5-[4-(4-phenylphenyl)piperazin-1-yl]pentanoate (PubChem CID 139943267) has the molecular formula C31H38N2O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is propan-2-yl 2-methyl-2-phenyl-5-[4-(4-phenylphenyl)piperazin-1-yl]pentanoate.
| Compound Name | propan-2-yl 2-methyl-2-phenyl-5-[4-(4-phenylphenyl)piperazin-1-yl]pentanoate |
|---|---|
| PubChem CID | 139943267 |
| Molecular Formula | C31H38N2O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | propan-2-yl 2-methyl-2-phenyl-5-[4-(4-phenylphenyl)piperazin-1-yl]pentanoate |
| SMILES | CC(C)OC(=O)C(C)(CCCN1CCN(c2ccc(-c3ccccc3)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C31H38N2O2/c1-25(2)35-30(34)31(3,28-13-8-5-9-14-28)19-10-20-32-21-23-33(24-22-32)29-17-15-27(16-18-29)26-11-6-4-7-12-26/h4-9,11-18,25H,10,19-24H2,1-3H3 |
| InChIKey | WSOHJBXHKUECAA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |