C31H37FN2O2 — CID 139943265
propyl 5-[4-[4-(2-fluorophenyl)phenyl]piperazin-1-yl]-2-methyl-2-phenylpentanoate (PubChem CID 139943265) has the molecular formula C31H37FN2O2 and a molecular weight of 488.65 g/mol. Its IUPAC name is propyl 5-[4-[4-(2-fluorophenyl)phenyl]piperazin-1-yl]-2-methyl-2-phenylpentanoate.
| Compound Name | propyl 5-[4-[4-(2-fluorophenyl)phenyl]piperazin-1-yl]-2-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 139943265 |
| Molecular Formula | C31H37FN2O2 |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | propyl 5-[4-[4-(2-fluorophenyl)phenyl]piperazin-1-yl]-2-methyl-2-phenylpentanoate |
| SMILES | CCCOC(=O)C(C)(CCCN1CCN(c2ccc(-c3ccccc3F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C31H37FN2O2/c1-3-24-36-30(35)31(2,26-10-5-4-6-11-26)18-9-19-33-20-22-34(23-21-33)27-16-14-25(15-17-27)28-12-7-8-13-29(28)32/h4-8,10-17H,3,9,18-24H2,1-2H3 |
| InChIKey | VOVMTHKZRPTPMN-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |