C32H39FN2O2 — CID 90947905
propan-2-yl 2-ethyl-5-[4-[4-(4-fluorophenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate (PubChem CID 90947905) has the molecular formula C32H39FN2O2 and a molecular weight of 502.67 g/mol. Its IUPAC name is propan-2-yl 2-ethyl-5-[4-[4-(4-fluorophenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate.
| Compound Name | propan-2-yl 2-ethyl-5-[4-[4-(4-fluorophenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate |
|---|---|
| PubChem CID | 90947905 |
| Molecular Formula | C32H39FN2O2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | propan-2-yl 2-ethyl-5-[4-[4-(4-fluorophenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate |
| SMILES | CCC(CCCN1CCN(c2ccc(-c3ccc(F)cc3)cc2)CC1)(C(=O)OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C32H39FN2O2/c1-4-32(31(36)37-25(2)3,28-9-6-5-7-10-28)19-8-20-34-21-23-35(24-22-34)30-17-13-27(14-18-30)26-11-15-29(33)16-12-26/h5-7,9-18,25H,4,8,19-24H2,1-3H3 |
| InChIKey | QOKCKBXNFQQEOO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |