C32H40N2O2 — CID 91085333
ethyl 2-ethyl-5-[4-[3-(3-methylphenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate (PubChem CID 91085333) has the molecular formula C32H40N2O2 and a molecular weight of 484.68 g/mol. Its IUPAC name is ethyl 2-ethyl-5-[4-[3-(3-methylphenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate.
| Compound Name | ethyl 2-ethyl-5-[4-[3-(3-methylphenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate |
|---|---|
| PubChem CID | 91085333 |
| Molecular Formula | C32H40N2O2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | ethyl 2-ethyl-5-[4-[3-(3-methylphenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate |
| SMILES | CCOC(=O)C(CC)(CCCN1CCN(c2cccc(-c3cccc(C)c3)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H40N2O2/c1-4-32(31(35)36-5-2,29-15-7-6-8-16-29)18-11-19-33-20-22-34(23-21-33)30-17-10-14-28(25-30)27-13-9-12-26(3)24-27/h6-10,12-17,24-25H,4-5,11,18-23H2,1-3H3 |
| InChIKey | FDQBPXFGFYDSSK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |