C25H34N2O2 — CID 142045206
methyl 3-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]-3-phenylhexanoate (PubChem CID 142045206) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is methyl 3-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]-3-phenylhexanoate.
| Compound Name | methyl 3-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]-3-phenylhexanoate |
|---|---|
| PubChem CID | 142045206 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | methyl 3-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]-3-phenylhexanoate |
| SMILES | COC(=O)CC(C)(CCCN1CCN(c2cccc(C)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H34N2O2/c1-21-9-7-12-23(19-21)27-17-15-26(16-18-27)14-8-13-25(2,20-24(28)29-3)22-10-5-4-6-11-22/h4-7,9-12,19H,8,13-18,20H2,1-3H3 |
| InChIKey | BNKQVNOMEAEMHJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |