C24H31BrN2O2 — CID 142045202
methyl 6-[4-(4-bromophenyl)piperazin-1-yl]-3-methyl-3-phenylhexanoate (PubChem CID 142045202) has the molecular formula C24H31BrN2O2 and a molecular weight of 459.43 g/mol. Its IUPAC name is methyl 6-[4-(4-bromophenyl)piperazin-1-yl]-3-methyl-3-phenylhexanoate.
| Compound Name | methyl 6-[4-(4-bromophenyl)piperazin-1-yl]-3-methyl-3-phenylhexanoate |
|---|---|
| PubChem CID | 142045202 |
| Molecular Formula | C24H31BrN2O2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | methyl 6-[4-(4-bromophenyl)piperazin-1-yl]-3-methyl-3-phenylhexanoate |
| SMILES | COC(=O)CC(C)(CCCN1CCN(c2ccc(Br)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H31BrN2O2/c1-24(19-23(28)29-2,20-7-4-3-5-8-20)13-6-14-26-15-17-27(18-16-26)22-11-9-21(25)10-12-22/h3-5,7-12H,6,13-19H2,1-2H3 |
| InChIKey | PDKNEYOVRBYAJG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |