C34H39F3N2O3 — CID 22995675
methyl 3-methyl-3-phenyl-7-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]heptanoate (PubChem CID 22995675) has the molecular formula C34H39F3N2O3 and a molecular weight of 580.69 g/mol. Its IUPAC name is methyl 3-methyl-3-phenyl-7-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]heptanoate.
| Compound Name | methyl 3-methyl-3-phenyl-7-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 22995675 |
| Molecular Formula | C34H39F3N2O3 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | methyl 3-methyl-3-phenyl-7-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]heptanoate |
| SMILES | COC(=O)CC(C)(CCCCN1CCC(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C34H39F3N2O3/c1-33(24-31(40)42-2,26-10-4-3-5-11-26)20-8-9-21-39-22-18-28(19-23-39)38-32(41)30-13-7-6-12-29(30)25-14-16-27(17-15-25)34(35,36)37/h3-7,10-17,28H,8-9,18-24H2,1-2H3,(H,38,41) |
| InChIKey | BNJRTKZTSMGESU-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|