C36H43F3N2O4 — CID 70027950
2-ethoxyethyl 3-methyl-3-phenyl-6-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]hexanoate (PubChem CID 70027950) has the molecular formula C36H43F3N2O4 and a molecular weight of 624.74 g/mol. Its IUPAC name is 2-ethoxyethyl 3-methyl-3-phenyl-6-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]hexanoate.
| Compound Name | 2-ethoxyethyl 3-methyl-3-phenyl-6-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 70027950 |
| Molecular Formula | C36H43F3N2O4 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | 2-ethoxyethyl 3-methyl-3-phenyl-6-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]hexanoate |
| SMILES | CCOCCOC(=O)CC(C)(CCCN1CCC(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C36H43F3N2O4/c1-3-44-24-25-45-33(42)26-35(2,28-10-5-4-6-11-28)20-9-21-41-22-18-30(19-23-41)40-34(43)32-13-8-7-12-31(32)27-14-16-29(17-15-27)36(37,38)39/h4-8,10-17,30H,3,9,18-26H2,1-2H3,(H,40,43) |
| InChIKey | CYNFNKITCIQWBV-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|