C35H41F3N2O3 — CID 22995521
methyl 3-ethyl-3-phenyl-7-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]heptanoate (PubChem CID 22995521) has the molecular formula C35H41F3N2O3 and a molecular weight of 594.72 g/mol. Its IUPAC name is methyl 3-ethyl-3-phenyl-7-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]heptanoate.
| Compound Name | methyl 3-ethyl-3-phenyl-7-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 22995521 |
| Molecular Formula | C35H41F3N2O3 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | methyl 3-ethyl-3-phenyl-7-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]heptanoate |
| SMILES | CCC(CCCCN1CCC(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)CC1)(CC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C35H41F3N2O3/c1-3-34(25-32(41)43-2,27-11-5-4-6-12-27)21-9-10-22-40-23-19-29(20-24-40)39-33(42)31-14-8-7-13-30(31)26-15-17-28(18-16-26)35(36,37)38/h4-8,11-18,29H,3,9-10,19-25H2,1-2H3,(H,39,42) |
| InChIKey | IOFWRLRBLOJKOI-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|