C32H37FN2O3 — CID 22995528
3-ethyl-6-[4-[[2-(3-fluorophenyl)benzoyl]amino]piperidin-1-yl]-3-phenylhexanoic acid (PubChem CID 22995528) has the molecular formula C32H37FN2O3 and a molecular weight of 516.66 g/mol. Its IUPAC name is 3-ethyl-6-[4-[[2-(3-fluorophenyl)benzoyl]amino]piperidin-1-yl]-3-phenylhexanoic acid.
| Compound Name | 3-ethyl-6-[4-[[2-(3-fluorophenyl)benzoyl]amino]piperidin-1-yl]-3-phenylhexanoic acid |
|---|---|
| PubChem CID | 22995528 |
| Molecular Formula | C32H37FN2O3 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 3-ethyl-6-[4-[[2-(3-fluorophenyl)benzoyl]amino]piperidin-1-yl]-3-phenylhexanoic acid |
| SMILES | CCC(CCCN1CCC(NC(=O)c2ccccc2-c2cccc(F)c2)CC1)(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C32H37FN2O3/c1-2-32(23-30(36)37,25-11-4-3-5-12-25)18-9-19-35-20-16-27(17-21-35)34-31(38)29-15-7-6-14-28(29)24-10-8-13-26(33)22-24/h3-8,10-15,22,27H,2,9,16-21,23H2,1H3,(H,34,38)(H,36,37) |
| InChIKey | KIPKGHLSJCHYRW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |