C33H39ClN2O3 — CID 22995732
methyl 6-[4-[[2-(3-chlorophenyl)benzoyl]amino]piperidin-1-yl]-3-ethyl-3-phenylhexanoate (PubChem CID 22995732) has the molecular formula C33H39ClN2O3 and a molecular weight of 547.14 g/mol. Its IUPAC name is methyl 6-[4-[[2-(3-chlorophenyl)benzoyl]amino]piperidin-1-yl]-3-ethyl-3-phenylhexanoate.
| Compound Name | methyl 6-[4-[[2-(3-chlorophenyl)benzoyl]amino]piperidin-1-yl]-3-ethyl-3-phenylhexanoate |
|---|---|
| PubChem CID | 22995732 |
| Molecular Formula | C33H39ClN2O3 |
| Molecular Weight | 547.14 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | methyl 6-[4-[[2-(3-chlorophenyl)benzoyl]amino]piperidin-1-yl]-3-ethyl-3-phenylhexanoate |
| SMILES | CCC(CCCN1CCC(NC(=O)c2ccccc2-c2cccc(Cl)c2)CC1)(CC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C33H39ClN2O3/c1-3-33(24-31(37)39-2,26-12-5-4-6-13-26)19-10-20-36-21-17-28(18-22-36)35-32(38)30-16-8-7-15-29(30)25-11-9-14-27(34)23-25/h4-9,11-16,23,28H,3,10,17-22,24H2,1-2H3,(H,35,38) |
| InChIKey | IKDZXBNRLSJCOG-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.14 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |