C37H45F3N2O3 — CID 22995586
butyl 3-ethyl-3-phenyl-6-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]hexanoate (PubChem CID 22995586) has the molecular formula C37H45F3N2O3 and a molecular weight of 622.77 g/mol. Its IUPAC name is butyl 3-ethyl-3-phenyl-6-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]hexanoate.
| Compound Name | butyl 3-ethyl-3-phenyl-6-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 22995586 |
| Molecular Formula | C37H45F3N2O3 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | butyl 3-ethyl-3-phenyl-6-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]hexanoate |
| SMILES | CCCCOC(=O)CC(CC)(CCCN1CCC(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C37H45F3N2O3/c1-3-5-26-45-34(43)27-36(4-2,29-12-7-6-8-13-29)22-11-23-42-24-20-31(21-25-42)41-35(44)33-15-10-9-14-32(33)28-16-18-30(19-17-28)37(38,39)40/h6-10,12-19,31H,3-5,11,20-27H2,1-2H3,(H,41,44) |
| InChIKey | HPIAXKXYXMIPBP-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|