C33H40F3N3O3 — CID 139949097
N-[1-[4-(2,6-diethoxyanilino)butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 139949097) has the molecular formula C33H40F3N3O3 and a molecular weight of 583.70 g/mol. Its IUPAC name is N-[1-[4-(2,6-diethoxyanilino)butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[1-[4-(2,6-diethoxyanilino)butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 139949097 |
| Molecular Formula | C33H40F3N3O3 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | N-[1-[4-(2,6-diethoxyanilino)butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOc1cccc(OCC)c1NCCCCN1CCC(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C33H40F3N3O3/c1-3-41-29-12-9-13-30(42-4-2)31(29)37-20-7-8-21-39-22-18-26(19-23-39)38-32(40)28-11-6-5-10-27(28)24-14-16-25(17-15-24)33(34,35)36/h5-6,9-17,26,37H,3-4,7-8,18-23H2,1-2H3,(H,38,40) |
| InChIKey | MTSLJPDQVKUISZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|