C38H46F3N3O2S2 — CID 139949151
N-[1-[4-[N-(cyclobutanecarbonyl)-2,6-bis(ethylsulfanyl)anilino]butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 139949151) has the molecular formula C38H46F3N3O2S2 and a molecular weight of 697.93 g/mol. Its IUPAC name is N-[1-[4-[N-(cyclobutanecarbonyl)-2,6-bis(ethylsulfanyl)anilino]butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[1-[4-[N-(cyclobutanecarbonyl)-2,6-bis(ethylsulfanyl)anilino]butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 139949151 |
| Molecular Formula | C38H46F3N3O2S2 |
| Molecular Weight | 697.93 g/mol |
| Exact Mass | 697.30 |
| IUPAC Name | N-[1-[4-[N-(cyclobutanecarbonyl)-2,6-bis(ethylsulfanyl)anilino]butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCSc1cccc(SCC)c1N(CCCCN1CCC(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)CC1)C(=O)C1CCC1 |
| InChI | InChI=1S/C38H46F3N3O2S2/c1-3-47-33-15-10-16-34(48-4-2)35(33)44(37(46)28-11-9-12-28)24-8-7-23-43-25-21-30(22-26-43)42-36(45)32-14-6-5-13-31(32)27-17-19-29(20-18-27)38(39,40)41/h5-6,10,13-20,28,30H,3-4,7-9,11-12,21-26H2,1-2H3,(H,42,45) |
| InChIKey | PEMJUVKFGHFURW-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.93 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|