C35H42F3N5O4 — CID 139949210
N-[(3S)-1-[4-[cyclobutanecarbonyl-(4,6-diethoxypyrimidin-5-yl)amino]butyl]pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 139949210) has the molecular formula C35H42F3N5O4 and a molecular weight of 653.75 g/mol. Its IUPAC name is N-[(3S)-1-[4-[cyclobutanecarbonyl-(4,6-diethoxypyrimidin-5-yl)amino]butyl]pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[(3S)-1-[4-[cyclobutanecarbonyl-(4,6-diethoxypyrimidin-5-yl)amino]butyl]pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 139949210 |
| Molecular Formula | C35H42F3N5O4 |
| Molecular Weight | 653.75 g/mol |
| Exact Mass | 653.32 |
| IUPAC Name | N-[(3S)-1-[4-[cyclobutanecarbonyl-(4,6-diethoxypyrimidin-5-yl)amino]butyl]pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOc1ncnc(OCC)c1N(CCCCN1CC[C@H](NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)C1)C(=O)C1CCC1 |
| InChI | InChI=1S/C35H42F3N5O4/c1-3-46-32-30(33(47-4-2)40-23-39-32)43(34(45)25-10-9-11-25)20-8-7-19-42-21-18-27(22-42)41-31(44)29-13-6-5-12-28(29)24-14-16-26(17-15-24)35(36,37)38/h5-6,12-17,23,25,27H,3-4,7-11,18-22H2,1-2H3,(H,41,44)/t27-/m0/s1 |
| InChIKey | AAHYLDBNDJVHOC-MHZLTWQESA-N |
| XLogP | 6.38 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.75 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|