C37H49N5O6 — CID 139949221
N-[1-[4-[cyclobutanecarbonyl-(4,6-diethoxypyrimidin-5-yl)amino]butyl]piperidin-4-yl]-2-(3,5-dimethoxyphenyl)benzamide (PubChem CID 139949221) has the molecular formula C37H49N5O6 and a molecular weight of 659.83 g/mol. Its IUPAC name is N-[1-[4-[cyclobutanecarbonyl-(4,6-diethoxypyrimidin-5-yl)amino]butyl]piperidin-4-yl]-2-(3,5-dimethoxyphenyl)benzamide.
| Compound Name | N-[1-[4-[cyclobutanecarbonyl-(4,6-diethoxypyrimidin-5-yl)amino]butyl]piperidin-4-yl]-2-(3,5-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 139949221 |
| Molecular Formula | C37H49N5O6 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.37 |
| IUPAC Name | N-[1-[4-[cyclobutanecarbonyl-(4,6-diethoxypyrimidin-5-yl)amino]butyl]piperidin-4-yl]-2-(3,5-dimethoxyphenyl)benzamide |
| SMILES | CCOc1ncnc(OCC)c1N(CCCCN1CCC(NC(=O)c2ccccc2-c2cc(OC)cc(OC)c2)CC1)C(=O)C1CCC1 |
| InChI | InChI=1S/C37H49N5O6/c1-5-47-35-33(36(48-6-2)39-25-38-35)42(37(44)26-12-11-13-26)19-10-9-18-41-20-16-28(17-21-41)40-34(43)32-15-8-7-14-31(32)27-22-29(45-3)24-30(23-27)46-4/h7-8,14-15,22-26,28H,5-6,9-13,16-21H2,1-4H3,(H,40,43) |
| InChIKey | VADNBIKSJUWENI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|