C23H29ClN2O2 — CID 15515475
methyl 5-[4-(3-chlorophenyl)piperazin-1-yl]-2-methyl-2-phenylpentanoate (PubChem CID 15515475) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is methyl 5-[4-(3-chlorophenyl)piperazin-1-yl]-2-methyl-2-phenylpentanoate.
| Compound Name | methyl 5-[4-(3-chlorophenyl)piperazin-1-yl]-2-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 15515475 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | methyl 5-[4-(3-chlorophenyl)piperazin-1-yl]-2-methyl-2-phenylpentanoate |
| SMILES | COC(=O)C(C)(CCCN1CCN(c2cccc(Cl)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H29ClN2O2/c1-23(22(27)28-2,19-8-4-3-5-9-19)12-7-13-25-14-16-26(17-15-25)21-11-6-10-20(24)18-21/h3-6,8-11,18H,7,12-17H2,1-2H3 |
| InChIKey | VUQYDWRKVGVDCF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |