C32H40N2O3 — CID 91481806
propyl 5-[4-[3-(3-methoxyphenyl)phenyl]piperazin-1-yl]-2-methyl-2-phenylpentanoate (PubChem CID 91481806) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is propyl 5-[4-[3-(3-methoxyphenyl)phenyl]piperazin-1-yl]-2-methyl-2-phenylpentanoate.
| Compound Name | propyl 5-[4-[3-(3-methoxyphenyl)phenyl]piperazin-1-yl]-2-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 91481806 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | propyl 5-[4-[3-(3-methoxyphenyl)phenyl]piperazin-1-yl]-2-methyl-2-phenylpentanoate |
| SMILES | CCCOC(=O)C(C)(CCCN1CCN(c2cccc(-c3cccc(OC)c3)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H40N2O3/c1-4-23-37-31(35)32(2,28-13-6-5-7-14-28)17-10-18-33-19-21-34(22-20-33)29-15-8-11-26(24-29)27-12-9-16-30(25-27)36-3/h5-9,11-16,24-25H,4,10,17-23H2,1-3H3 |
| InChIKey | OUYIINWVJOUBEI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |