C31H38N2O3 — CID 139943242
methyl 2-ethyl-5-[4-[3-(4-methoxyphenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate (PubChem CID 139943242) has the molecular formula C31H38N2O3 and a molecular weight of 486.66 g/mol. Its IUPAC name is methyl 2-ethyl-5-[4-[3-(4-methoxyphenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate.
| Compound Name | methyl 2-ethyl-5-[4-[3-(4-methoxyphenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate |
|---|---|
| PubChem CID | 139943242 |
| Molecular Formula | C31H38N2O3 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | methyl 2-ethyl-5-[4-[3-(4-methoxyphenyl)phenyl]piperazin-1-yl]-2-phenylpentanoate |
| SMILES | CCC(CCCN1CCN(c2cccc(-c3ccc(OC)cc3)c2)CC1)(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C31H38N2O3/c1-4-31(30(34)36-3,27-11-6-5-7-12-27)18-9-19-32-20-22-33(23-21-32)28-13-8-10-26(24-28)25-14-16-29(35-2)17-15-25/h5-8,10-17,24H,4,9,18-23H2,1-3H3 |
| InChIKey | QJEXISIYKDWERN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |