C32H39ClN2O2 — CID 90973274
propan-2-yl 5-[4-[3-(4-chlorophenyl)phenyl]piperazin-1-yl]-2-ethyl-2-phenylpentanoate (PubChem CID 90973274) has the molecular formula C32H39ClN2O2 and a molecular weight of 519.13 g/mol. Its IUPAC name is propan-2-yl 5-[4-[3-(4-chlorophenyl)phenyl]piperazin-1-yl]-2-ethyl-2-phenylpentanoate.
| Compound Name | propan-2-yl 5-[4-[3-(4-chlorophenyl)phenyl]piperazin-1-yl]-2-ethyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 90973274 |
| Molecular Formula | C32H39ClN2O2 |
| Molecular Weight | 519.13 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | propan-2-yl 5-[4-[3-(4-chlorophenyl)phenyl]piperazin-1-yl]-2-ethyl-2-phenylpentanoate |
| SMILES | CCC(CCCN1CCN(c2cccc(-c3ccc(Cl)cc3)c2)CC1)(C(=O)OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C32H39ClN2O2/c1-4-32(31(36)37-25(2)3,28-11-6-5-7-12-28)18-9-19-34-20-22-35(23-21-34)30-13-8-10-27(24-30)26-14-16-29(33)17-15-26/h5-8,10-17,24-25H,4,9,18-23H2,1-3H3 |
| InChIKey | RGVRFFNHZZAEPM-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.13 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |