C26H35ClN2O2 — CID 139943299
propan-2-yl 5-[4-(4-chlorophenyl)piperazin-1-yl]-2-ethyl-2-phenylpentanoate (PubChem CID 139943299) has the molecular formula C26H35ClN2O2 and a molecular weight of 443.03 g/mol. Its IUPAC name is propan-2-yl 5-[4-(4-chlorophenyl)piperazin-1-yl]-2-ethyl-2-phenylpentanoate.
| Compound Name | propan-2-yl 5-[4-(4-chlorophenyl)piperazin-1-yl]-2-ethyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 139943299 |
| Molecular Formula | C26H35ClN2O2 |
| Molecular Weight | 443.03 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | propan-2-yl 5-[4-(4-chlorophenyl)piperazin-1-yl]-2-ethyl-2-phenylpentanoate |
| SMILES | CCC(CCCN1CCN(c2ccc(Cl)cc2)CC1)(C(=O)OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H35ClN2O2/c1-4-26(25(30)31-21(2)3,22-9-6-5-7-10-22)15-8-16-28-17-19-29(20-18-28)24-13-11-23(27)12-14-24/h5-7,9-14,21H,4,8,15-20H2,1-3H3 |
| InChIKey | ILCHDRMTAPBWEG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.03 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |